C14H13NO2 — CID 135025433
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpyridine (PubChem CID 135025433) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpyridine.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 135025433 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpyridine |
| SMILES | Cc1ccnc(C2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C14H13NO2/c1-10-6-7-15-11(8-10)14-9-16-12-4-2-3-5-13(12)17-14/h2-8,14H,9H2,1H3 |
| InChIKey | QWIWXAXLQYTDHP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |