C19H16ClNO4S — CID 2836304
2,4-bis(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole;hydrochloride (PubChem CID 2836304) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2,4-bis(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole;hydrochloride.
| Compound Name | 2,4-bis(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 2836304 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2,4-bis(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)OCC(c1csc(C3COc4ccccc4O3)n1)O2 |
| InChI | InChI=1S/C19H15NO4S.ClH/c1-3-7-15-13(5-1)21-9-17(23-15)12-11-25-19(20-12)18-10-22-14-6-2-4-8-16(14)24-18;/h1-8,11,17-18H,9-10H2;1H |
| InChIKey | CHEMBIRUPSGKBD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |