C12H10ClNO2S — CID 65351203
4-(chloromethyl)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole (PubChem CID 65351203) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 65351203 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 4-(chloromethyl)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole |
| SMILES | ClCc1csc(C2COc3ccccc3O2)n1 |
| InChI | InChI=1S/C12H10ClNO2S/c13-5-8-7-17-12(14-8)11-6-15-9-3-1-2-4-10(9)16-11/h1-4,7,11H,5-6H2 |
| InChIKey | BIDHMMFYWXZRRB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|