C17H13NO4S2 — CID 2821637
S-(furan-2-ylmethyl) 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole-4-carbothioate (PubChem CID 2821637) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is S-(furan-2-ylmethyl) 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole-4-carbothioate.
| Compound Name | S-(furan-2-ylmethyl) 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole-4-carbothioate |
|---|---|
| PubChem CID | 2821637 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | S-(furan-2-ylmethyl) 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazole-4-carbothioate |
| SMILES | O=C(SCc1ccco1)c1csc(C2COc3ccccc3O2)n1 |
| InChI | InChI=1S/C17H13NO4S2/c19-17(24-9-11-4-3-7-20-11)12-10-23-16(18-12)15-8-21-13-5-1-2-6-14(13)22-15/h1-7,10,15H,8-9H2 |
| InChIKey | MOXDUFKMSKOCFC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|