C12H13ClN4O2S — CID 12005580
2-[4-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 12005580) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 12005580 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(C2COc3ccccc3O2)cs1 |
| InChI | InChI=1S/C12H12N4O2S.ClH/c13-11(14)16-12-15-7(6-19-12)10-5-17-8-3-1-2-4-9(8)18-10;/h1-4,6,10H,5H2,(H4,13,14,15,16);1H |
| InChIKey | WSMLKSYKSHCZIY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|