C12H10N2O3S — CID 793118
N-[4-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3-thiazol-2-yl]formamide (PubChem CID 793118) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[4-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3-thiazol-2-yl]formamide.
| Compound Name | N-[4-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3-thiazol-2-yl]formamide |
|---|---|
| PubChem CID | 793118 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-[4-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3-thiazol-2-yl]formamide |
| SMILES | O=CNc1nc([C@H]2COc3ccccc3O2)cs1 |
| InChI | InChI=1S/C12H10N2O3S/c15-7-13-12-14-8(6-18-12)11-5-16-9-3-1-2-4-10(9)17-11/h1-4,6-7,11H,5H2,(H,13,14,15)/t11-/m1/s1 |
| InChIKey | YXQNIFCRMIMUPG-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|