C11H9ClN2O3 — CID 5190640
2-(chloromethyl)-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole (PubChem CID 5190640) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 5190640 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-(chloromethyl)-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole |
| SMILES | ClCc1nnc(C2COc3ccccc3O2)o1 |
| InChI | InChI=1S/C11H9ClN2O3/c12-5-10-13-14-11(17-10)9-6-15-7-3-1-2-4-8(7)16-9/h1-4,9H,5-6H2 |
| InChIKey | ZEFCHDBLDYNPBT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|