C18H19N3O3 — CID 135025532
tert-butyl N-(2-benzamidophenyl)iminocarbamate (PubChem CID 135025532) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl N-(2-benzamidophenyl)iminocarbamate.
| Compound Name | tert-butyl N-(2-benzamidophenyl)iminocarbamate |
|---|---|
| PubChem CID | 135025532 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-(2-benzamidophenyl)iminocarbamate |
| SMILES | CC(C)(C)OC(=O)/N=N/c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O3/c1-18(2,3)24-17(23)21-20-15-12-8-7-11-14(15)19-16(22)13-9-5-4-6-10-13/h4-12H,1-3H3,(H,19,22)/b21-20+ |
| InChIKey | CSTAFWTUHXABPL-QZQOTICOSA-N |
| XLogP | 4.96 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|