C15H12FN3O2 — CID 135025593
ethyl 6-fluoro-1-pyrimidin-2-ylindole-2-carboxylate (PubChem CID 135025593) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is ethyl 6-fluoro-1-pyrimidin-2-ylindole-2-carboxylate.
| Compound Name | ethyl 6-fluoro-1-pyrimidin-2-ylindole-2-carboxylate |
|---|---|
| PubChem CID | 135025593 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethyl 6-fluoro-1-pyrimidin-2-ylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(F)cc2n1-c1ncccn1 |
| InChI | InChI=1S/C15H12FN3O2/c1-2-21-14(20)13-8-10-4-5-11(16)9-12(10)19(13)15-17-6-3-7-18-15/h3-9H,2H2,1H3 |
| InChIKey | DXUZMOORCXLMSX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |