C27H21NO3 — CID 135026182
methyl (4Z)-1-benzoyl-4-benzylidene-1,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate (PubChem CID 135026182) has the molecular formula C27H21NO3 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl (4Z)-1-benzoyl-4-benzylidene-1,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate.
| Compound Name | methyl (4Z)-1-benzoyl-4-benzylidene-1,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 135026182 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl (4Z)-1-benzoyl-4-benzylidene-1,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)C12N=CC(C(=O)c3ccccc3)C1c1ccccc1/C2=C/c1ccccc1 |
| InChI | InChI=1S/C27H21NO3/c1-31-26(30)27-23(16-18-10-4-2-5-11-18)20-14-8-9-15-21(20)24(27)22(17-28-27)25(29)19-12-6-3-7-13-19/h2-17,22,24H,1H3/b23-16- |
| InChIKey | PSVRISHNIDXAOE-KQWNVCNZSA-N |
| XLogP | 4.82 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|