C28H23NO3 — CID 139037541
methyl (3aS,4Z,8bR)-4-benzylidene-1-(4-methylbenzoyl)-3,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate (PubChem CID 139037541) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl (3aS,4Z,8bR)-4-benzylidene-1-(4-methylbenzoyl)-3,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,4Z,8bR)-4-benzylidene-1-(4-methylbenzoyl)-3,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 139037541 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl (3aS,4Z,8bR)-4-benzylidene-1-(4-methylbenzoyl)-3,8b-dihydroindeno[2,1-b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@]12NC=C(C(=O)c3ccc(C)cc3)[C@H]1c1ccccc1/C2=C/c1ccccc1 |
| InChI | InChI=1S/C28H23NO3/c1-18-12-14-20(15-13-18)26(30)23-17-29-28(27(31)32-2)24(16-19-8-4-3-5-9-19)21-10-6-7-11-22(21)25(23)28/h3-17,25,29H,1-2H3/b24-16-/t25-,28-/m1/s1 |
| InChIKey | LFYYYMYWXAZJAE-HPXOMDEJSA-N |
| XLogP | 4.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|