C33H29NO4 — CID 101072587
methyl (2S)-4-benzoyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate (PubChem CID 101072587) has the molecular formula C33H29NO4 and a molecular weight of 503.60 g/mol. Its IUPAC name is methyl (2S)-4-benzoyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate.
| Compound Name | methyl (2S)-4-benzoyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate |
|---|---|
| PubChem CID | 101072587 |
| Molecular Formula | C33H29NO4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | methyl (2S)-4-benzoyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate |
| SMILES | COC(=O)[C@H](CC(C(C)=O)C(=O)c1ccccc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H29NO4/c1-22(35)27(31(36)23-13-5-3-6-14-23)21-30(32(37)38-2)34-33(24-15-7-4-8-16-24)28-19-11-9-17-25(28)26-18-10-12-20-29(26)33/h3-20,27,30,34H,21H2,1-2H3/t27?,30-/m0/s1 |
| InChIKey | BJRFOOLWSZNKRK-MILIPEGGSA-N |
| XLogP | 5.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|