C28H29NO3 — CID 11026334
(2S)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoic acid (PubChem CID 11026334) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is (2S)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoic acid.
| Compound Name | (2S)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoic acid |
|---|---|
| PubChem CID | 11026334 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (2S)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoic acid |
| SMILES | CC(C)(C)C(=O)CC[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C28H29NO3/c1-27(2,3)25(30)18-17-24(26(31)32)29-28(19-11-5-4-6-12-19)22-15-9-7-13-20(22)21-14-8-10-16-23(21)28/h4-16,24,29H,17-18H2,1-3H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | SGFVTFYOXRWWAZ-DEOSSOPVSA-N |
| XLogP | 5.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |