C28H23NO3 — CID 135026239
ethyl 3-phenyl-4-[2-(2-phenylethynyl)benzoyl]-2,3-dihydro-1H-pyrrole-2-carboxylate (PubChem CID 135026239) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 3-phenyl-4-[2-(2-phenylethynyl)benzoyl]-2,3-dihydro-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-phenyl-4-[2-(2-phenylethynyl)benzoyl]-2,3-dihydro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135026239 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | ethyl 3-phenyl-4-[2-(2-phenylethynyl)benzoyl]-2,3-dihydro-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1NC=C(C(=O)c2ccccc2C#Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C28H23NO3/c1-2-32-28(31)26-25(22-14-7-4-8-15-22)24(19-29-26)27(30)23-16-10-9-13-21(23)18-17-20-11-5-3-6-12-20/h3-16,19,25-26,29H,2H2,1H3 |
| InChIKey | VTMISCDLZRXYOE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|