C21H20INO3 — CID 134838428
ethyl 4-(2-iodobenzoyl)-3-(4-methylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylate (PubChem CID 134838428) has the molecular formula C21H20INO3 and a molecular weight of 461.30 g/mol. Its IUPAC name is ethyl 4-(2-iodobenzoyl)-3-(4-methylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-(2-iodobenzoyl)-3-(4-methylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134838428 |
| Molecular Formula | C21H20INO3 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | ethyl 4-(2-iodobenzoyl)-3-(4-methylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1NC=C(C(=O)c2ccccc2I)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20INO3/c1-3-26-21(25)19-18(14-10-8-13(2)9-11-14)16(12-23-19)20(24)15-6-4-5-7-17(15)22/h4-12,18-19,23H,3H2,1-2H3 |
| InChIKey | YNZBMRGAERFVPU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|