C22H23NO5 — CID 134943133
diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-2,2-dicarboxylate (PubChem CID 134943133) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134943133 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](C(=O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-3-27-20(25)22(21(26)28-4-2)17(15-11-7-5-8-12-15)18(23-22)19(24)16-13-9-6-10-14-16/h5-14,17-18,23H,3-4H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | QKWQXFMTMWPOBF-MSOLQXFVSA-N |
| XLogP | 2.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|