C30H31NO6 — CID 135064884
diethyl 2-benzamido-2-[3-(4-methylphenyl)-3-oxo-1-phenylpropyl]propanedioate (PubChem CID 135064884) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is diethyl 2-benzamido-2-[3-(4-methylphenyl)-3-oxo-1-phenylpropyl]propanedioate.
| Compound Name | diethyl 2-benzamido-2-[3-(4-methylphenyl)-3-oxo-1-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 135064884 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | diethyl 2-benzamido-2-[3-(4-methylphenyl)-3-oxo-1-phenylpropyl]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)(C(=O)OCC)C(CC(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO6/c1-4-36-28(34)30(29(35)37-5-2,31-27(33)24-14-10-7-11-15-24)25(22-12-8-6-9-13-22)20-26(32)23-18-16-21(3)17-19-23/h6-19,25H,4-5,20H2,1-3H3,(H,31,33) |
| InChIKey | RZCLKUXRCJBWAB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|