C27H31NO7 — CID 134943132
1-O-tert-butyl 2-O,2-O'-diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-1,2,2-tricarboxylate (PubChem CID 134943132) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,2-O'-diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-1,2,2-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,2-O'-diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 134943132 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-O-tert-butyl 2-O,2-O'-diethyl (3R,4S)-4-benzoyl-3-phenylazetidine-1,2,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccccc2)[C@@H](C(=O)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H31NO7/c1-6-33-23(30)27(24(31)34-7-2)20(18-14-10-8-11-15-18)21(22(29)19-16-12-9-13-17-19)28(27)25(32)35-26(3,4)5/h8-17,20-21H,6-7H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | PPDMQWXITGATEJ-RTWAWAEBSA-N |
| XLogP | 4.14 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|