C29H26ClNO6 — CID 46845581
diethyl (3R,4S)-1,4-dibenzoyl-3-(4-chlorophenyl)azetidine-2,2-dicarboxylate (PubChem CID 46845581) has the molecular formula C29H26ClNO6 and a molecular weight of 519.98 g/mol. Its IUPAC name is diethyl (3R,4S)-1,4-dibenzoyl-3-(4-chlorophenyl)azetidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4S)-1,4-dibenzoyl-3-(4-chlorophenyl)azetidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 46845581 |
| Molecular Formula | C29H26ClNO6 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | diethyl (3R,4S)-1,4-dibenzoyl-3-(4-chlorophenyl)azetidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)c2ccccc2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26ClNO6/c1-3-36-27(34)29(28(35)37-4-2)23(19-15-17-22(30)18-16-19)24(25(32)20-11-7-5-8-12-20)31(29)26(33)21-13-9-6-10-14-21/h5-18,23-24H,3-4H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | ZOXVQHHAFVJCHS-RPWUZVMVSA-N |
| XLogP | 4.70 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|