C29H28ClNO6 — CID 46845580
diethyl 2-benzamido-2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioate (PubChem CID 46845580) has the molecular formula C29H28ClNO6 and a molecular weight of 522.00 g/mol. Its IUPAC name is diethyl 2-benzamido-2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioate.
| Compound Name | diethyl 2-benzamido-2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 46845580 |
| Molecular Formula | C29H28ClNO6 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | diethyl 2-benzamido-2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)(C(=O)OCC)C(CC(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClNO6/c1-3-36-27(34)29(28(35)37-4-2,31-26(33)22-13-9-6-10-14-22)24(20-15-17-23(30)18-16-20)19-25(32)21-11-7-5-8-12-21/h5-18,24H,3-4,19H2,1-2H3,(H,31,33) |
| InChIKey | XCOMULTTYRRPEW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|