C28H24ClNO5 — CID 52915218
ethyl (4S,5R)-5-benzamido-5-benzyl-4-(4-chlorophenyl)-6-oxo-4H-pyran-2-carboxylate (PubChem CID 52915218) has the molecular formula C28H24ClNO5 and a molecular weight of 489.96 g/mol. Its IUPAC name is ethyl (4S,5R)-5-benzamido-5-benzyl-4-(4-chlorophenyl)-6-oxo-4H-pyran-2-carboxylate.
| Compound Name | ethyl (4S,5R)-5-benzamido-5-benzyl-4-(4-chlorophenyl)-6-oxo-4H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 52915218 |
| Molecular Formula | C28H24ClNO5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | ethyl (4S,5R)-5-benzamido-5-benzyl-4-(4-chlorophenyl)-6-oxo-4H-pyran-2-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](c2ccc(Cl)cc2)[C@@](Cc2ccccc2)(NC(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C28H24ClNO5/c1-2-34-26(32)24-17-23(20-13-15-22(29)16-14-20)28(27(33)35-24,18-19-9-5-3-6-10-19)30-25(31)21-11-7-4-8-12-21/h3-17,23H,2,18H2,1H3,(H,30,31)/t23-,28+/m0/s1 |
| InChIKey | HAHBNXVEIDZBHX-NEKDWFFYSA-N |
| XLogP | 4.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |