C35H34INO7 — CID 134943137
diethyl 2-benzamido-2-[2-[hydroxy(phenyl)-λ3-iodanyl]-3-oxo-1,3-diphenylpropyl]propanedioate (PubChem CID 134943137) has the molecular formula C35H34INO7 and a molecular weight of 707.56 g/mol. Its IUPAC name is diethyl 2-benzamido-2-[2-[hydroxy(phenyl)-λ3-iodanyl]-3-oxo-1,3-diphenylpropyl]propanedioate.
| Compound Name | diethyl 2-benzamido-2-[2-[hydroxy(phenyl)-λ3-iodanyl]-3-oxo-1,3-diphenylpropyl]propanedioate |
|---|---|
| PubChem CID | 134943137 |
| Molecular Formula | C35H34INO7 |
| Molecular Weight | 707.56 g/mol |
| Exact Mass | 707.14 |
| IUPAC Name | diethyl 2-benzamido-2-[2-[hydroxy(phenyl)-λ3-iodanyl]-3-oxo-1,3-diphenylpropyl]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)(C(=O)OCC)C(c1ccccc1)C(C(=O)c1ccccc1)I(O)c1ccccc1 |
| InChI | InChI=1S/C35H34INO7/c1-3-43-33(40)35(34(41)44-4-2,37-32(39)27-21-13-7-14-22-27)29(25-17-9-5-10-18-25)30(31(38)26-19-11-6-12-20-26)36(42)28-23-15-8-16-24-28/h5-24,29-30,42H,3-4H2,1-2H3,(H,37,39) |
| InChIKey | FSPGNPJEGDRQAC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|