C23H24ClNO5 — CID 134947201
methyl (E,2R)-5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-phenylpent-4-enoate (PubChem CID 134947201) has the molecular formula C23H24ClNO5 and a molecular weight of 429.90 g/mol. Its IUPAC name is methyl (E,2R)-5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-phenylpent-4-enoate.
| Compound Name | methyl (E,2R)-5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-phenylpent-4-enoate |
|---|---|
| PubChem CID | 134947201 |
| Molecular Formula | C23H24ClNO5 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | methyl (E,2R)-5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-phenylpent-4-enoate |
| SMILES | COC(=O)[C@](NC(=O)OC(C)(C)C)(C(=O)/C=C/c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H24ClNO5/c1-22(2,3)30-21(28)25-23(20(27)29-4,17-8-6-5-7-9-17)19(26)15-12-16-10-13-18(24)14-11-16/h5-15H,1-4H3,(H,25,28)/b15-12+/t23-/m1/s1 |
| InChIKey | UYXPFNMTPDRKIH-MEWQITQSSA-N |
| XLogP | 4.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|