C20H27ClFNO6 — CID 140875582
tert-butyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxoethoxy)propanoate (PubChem CID 140875582) has the molecular formula C20H27ClFNO6 and a molecular weight of 431.89 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxoethoxy)propanoate.
| Compound Name | tert-butyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxoethoxy)propanoate |
|---|---|
| PubChem CID | 140875582 |
| Molecular Formula | C20H27ClFNO6 |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | tert-butyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxoethoxy)propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@](COCC=O)(C(=O)OC(C)(C)C)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H27ClFNO6/c1-18(2,3)28-16(25)20(12-27-10-9-24,23-17(26)29-19(4,5)6)13-7-8-14(21)15(22)11-13/h7-9,11H,10,12H2,1-6H3,(H,23,26)/t20-/m1/s1 |
| InChIKey | LNHRPRKMXOQYCP-HXUWFJFHSA-N |
| XLogP | 3.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|