C16H20ClNO6 — CID 102337464
methyl 3-(4-chlorophenyl)-2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-oxopropanoate (PubChem CID 102337464) has the molecular formula C16H20ClNO6 and a molecular weight of 357.79 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-oxopropanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 102337464 |
| Molecular Formula | C16H20ClNO6 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)(C(=O)c1ccc(Cl)cc1)N(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20ClNO6/c1-15(2,3)24-14(21)18(22)16(4,13(20)23-5)12(19)10-6-8-11(17)9-7-10/h6-9,22H,1-5H3 |
| InChIKey | CLMUOIWXUFZELH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|