C17H22ClNO5 — CID 139836665
propyl 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate (PubChem CID 139836665) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is propyl 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate.
| Compound Name | propyl 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 139836665 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | propyl 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate |
| SMILES | CCCOC(=O)C(NC(=O)OC(C)(C)C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO5/c1-5-10-23-15(21)13(19-16(22)24-17(2,3)4)14(20)11-6-8-12(18)9-7-11/h6-9,13H,5,10H2,1-4H3,(H,19,22) |
| InChIKey | FTSURBPSZGRYJQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|