C17H20ClNO5 — CID 66552559
1-O-tert-butyl 2-O-ethyl (2R)-2-(4-chlorobenzoyl)aziridine-1,2-dicarboxylate (PubChem CID 66552559) has the molecular formula C17H20ClNO5 and a molecular weight of 353.80 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R)-2-(4-chlorobenzoyl)aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R)-2-(4-chlorobenzoyl)aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66552559 |
| Molecular Formula | C17H20ClNO5 |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R)-2-(4-chlorobenzoyl)aziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@]1(C(=O)c2ccc(Cl)cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20ClNO5/c1-5-23-14(21)17(10-19(17)15(22)24-16(2,3)4)13(20)11-6-8-12(18)9-7-11/h6-9H,5,10H2,1-4H3/t17-,19?/m1/s1 |
| InChIKey | ZTROGACURLZIEB-DUSLRRAJSA-N |
| XLogP | 3.08 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|