C22H21ClF3NO3 — CID 177424826
tert-butyl N-[(Z)-2-(4-chlorophenyl)-1,1,1-trifluoro-3-oxo-5-phenylpent-4-en-2-yl]carbamate (PubChem CID 177424826) has the molecular formula C22H21ClF3NO3 and a molecular weight of 439.86 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-(4-chlorophenyl)-1,1,1-trifluoro-3-oxo-5-phenylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-(4-chlorophenyl)-1,1,1-trifluoro-3-oxo-5-phenylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 177424826 |
| Molecular Formula | C22H21ClF3NO3 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | tert-butyl N-[(Z)-2-(4-chlorophenyl)-1,1,1-trifluoro-3-oxo-5-phenylpent-4-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)/C=C\c1ccccc1)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H21ClF3NO3/c1-20(2,3)30-19(29)27-21(22(24,25)26,16-10-12-17(23)13-11-16)18(28)14-9-15-7-5-4-6-8-15/h4-14H,1-3H3,(H,27,29)/b14-9- |
| InChIKey | LQICEVSEJGSKPF-ZROIWOOFSA-N |
| XLogP | 5.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|