C21H22BClF3NO4 — CID 58361591
[(2R)-1-(4-chlorophenyl)-5-methyl-4-oxo-5-[[2-(trifluoromethyl)benzoyl]amino]hexan-2-yl]boronic acid (PubChem CID 58361591) has the molecular formula C21H22BClF3NO4 and a molecular weight of 455.67 g/mol. Its IUPAC name is [(2R)-1-(4-chlorophenyl)-5-methyl-4-oxo-5-[[2-(trifluoromethyl)benzoyl]amino]hexan-2-yl]boronic acid.
| Compound Name | [(2R)-1-(4-chlorophenyl)-5-methyl-4-oxo-5-[[2-(trifluoromethyl)benzoyl]amino]hexan-2-yl]boronic acid |
|---|---|
| PubChem CID | 58361591 |
| Molecular Formula | C21H22BClF3NO4 |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [(2R)-1-(4-chlorophenyl)-5-methyl-4-oxo-5-[[2-(trifluoromethyl)benzoyl]amino]hexan-2-yl]boronic acid |
| SMILES | CC(C)(NC(=O)c1ccccc1C(F)(F)F)C(=O)C[C@@H](Cc1ccc(Cl)cc1)B(O)O |
| InChI | InChI=1S/C21H22BClF3NO4/c1-20(2,27-19(29)16-5-3-4-6-17(16)21(24,25)26)18(28)12-14(22(30)31)11-13-7-9-15(23)10-8-13/h3-10,14,30-31H,11-12H2,1-2H3,(H,27,29)/t14-/m1/s1 |
| InChIKey | BMACJYBOUMGVOJ-CQSZACIVSA-N |
| XLogP | 3.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|