C16H11ClF7NO2 — CID 91694659
N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 91694659) has the molecular formula C16H11ClF7NO2 and a molecular weight of 417.71 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 91694659 |
| Molecular Formula | C16H11ClF7NO2 |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C1C=CCCC1(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C16H11ClF7NO2/c17-10-6-2-1-5-9(10)13(8-4-3-7-11(13)26)25-12(27)14(18,19)15(20,21)16(22,23)24/h1-3,5-7H,4,8H2,(H,25,27) |
| InChIKey | QOAZHQRCHDKQKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|