C22H20F3NO3 — CID 134947199
tert-butyl N-[(2R)-1,1,1-trifluoro-3-oxo-2,5-diphenylpent-4-yn-2-yl]carbamate (PubChem CID 134947199) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1,1,1-trifluoro-3-oxo-2,5-diphenylpent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1,1,1-trifluoro-3-oxo-2,5-diphenylpent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 134947199 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | tert-butyl N-[(2R)-1,1,1-trifluoro-3-oxo-2,5-diphenylpent-4-yn-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C(=O)C#Cc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H20F3NO3/c1-20(2,3)29-19(28)26-21(22(23,24)25,17-12-8-5-9-13-17)18(27)15-14-16-10-6-4-7-11-16/h4-13H,1-3H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | HPDRNKGRJIHURA-OAQYLSRUSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|