C25H28N2O2 — CID 135026245
(E,4R)-2-ethyl-4-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-phenyl-N-prop-2-enylbut-2-enamide (PubChem CID 135026245) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (E,4R)-2-ethyl-4-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-phenyl-N-prop-2-enylbut-2-enamide.
| Compound Name | (E,4R)-2-ethyl-4-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-phenyl-N-prop-2-enylbut-2-enamide |
|---|---|
| PubChem CID | 135026245 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (E,4R)-2-ethyl-4-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-phenyl-N-prop-2-enylbut-2-enamide |
| SMILES | C=CCN(CCc1c[nH]c2ccccc12)C(=O)/C(=C/[C@@H](O)c1ccccc1)CC |
| InChI | InChI=1S/C25H28N2O2/c1-3-15-27(16-14-21-18-26-23-13-9-8-12-22(21)23)25(29)19(4-2)17-24(28)20-10-6-5-7-11-20/h3,5-13,17-18,24,26,28H,1,4,14-16H2,2H3/b19-17+/t24-/m1/s1 |
| InChIKey | PBNIKDFBSRWNOR-HJMGBZSKSA-N |
| XLogP | 4.80 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|