About 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline
3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline (PubChem CID 135026325) has the molecular formula C19H11F3N2
and a molecular weight of 324.31 g/mol. Its IUPAC name is 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline |
| PubChem CID | 135026325 |
| Molecular Formula | C19H11F3N2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline |
| SMILES | FC(F)(F)c1nc2c(ccc3cccnc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C19H11F3N2/c20-19(21,22)18-15(12-5-2-1-3-6-12)11-14-9-8-13-7-4-10-23-16(13)17(14)24-18/h1-11H |
| InChIKey | VLKJTLXHZHAZOE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline?
The IUPAC name of 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline (CID 135026325) is 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline.
What is the SMILES notation for 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline?
The canonical SMILES for 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline is FC(F)(F)c1nc2c(ccc3cccnc32)cc1-c1ccccc1.
What is the InChIKey of 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline?
The InChIKey is VLKJTLXHZHAZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N2/c20-19(21,22)18-15(12-5-2-1-3-6-12)11-14-9-8-13-7-4-10-23-16(13)17(14)24-18/h1-11H.
What are the key properties of 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline?
3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline has a molecular weight of 324.31 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-(trifluoromethyl)-1,10-phenanthroline is sourced from PubChem (CID 135026325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).