C12H17F2IO4 — CID 135026606
ethyl 2,2-difluoro-5-iodo-3-methyl-9-oxooxonane-5-carboxylate (PubChem CID 135026606) has the molecular formula C12H17F2IO4 and a molecular weight of 390.16 g/mol. Its IUPAC name is ethyl 2,2-difluoro-5-iodo-3-methyl-9-oxooxonane-5-carboxylate.
| Compound Name | ethyl 2,2-difluoro-5-iodo-3-methyl-9-oxooxonane-5-carboxylate |
|---|---|
| PubChem CID | 135026606 |
| Molecular Formula | C12H17F2IO4 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | ethyl 2,2-difluoro-5-iodo-3-methyl-9-oxooxonane-5-carboxylate |
| SMILES | CCOC(=O)C1(I)CCCC(=O)OC(F)(F)C(C)C1 |
| InChI | InChI=1S/C12H17F2IO4/c1-3-18-10(17)11(15)6-4-5-9(16)19-12(13,14)8(2)7-11/h8H,3-7H2,1-2H3 |
| InChIKey | RASWBZZOJJTTOH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|