C16H19NO4 — CID 135026657
(1S,5R,6S,8S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one (PubChem CID 135026657) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S,5R,6S,8S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,5R,6S,8S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 135026657 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1S,5R,6S,8S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
| SMILES | C=C[C@@H]1O[C@H](CO)[C@H]2C(=O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-2-13-12-10-20-17(8-11-6-4-3-5-7-11)15(16(12)19)14(9-18)21-13/h2-7,12-15,18H,1,8-10H2/t12-,13+,14-,15+/m1/s1 |
| InChIKey | WSBSRNDZZJWCOQ-BARDWOONSA-N |
| XLogP | 0.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|