C25H35NO3Si — CID 135027270
methyl (2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-3-carboxylate (PubChem CID 135027270) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is methyl (2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 135027270 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | methyl (2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCN[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H35NO3Si/c1-25(2,3)30(20-12-7-5-8-13-20,21-14-9-6-10-15-21)29-19-11-16-23-22(17-18-26-23)24(27)28-4/h5-10,12-15,22-23,26H,11,16-19H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | RPNNAGUPLGOYNR-GOTSBHOMSA-N |
| XLogP | 3.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|