C16H9F3O — CID 135027317
3-fluoro-2,4-bis(4-fluorophenyl)furan (PubChem CID 135027317) has the molecular formula C16H9F3O and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-fluoro-2,4-bis(4-fluorophenyl)furan.
| Compound Name | 3-fluoro-2,4-bis(4-fluorophenyl)furan |
|---|---|
| PubChem CID | 135027317 |
| Molecular Formula | C16H9F3O |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-fluoro-2,4-bis(4-fluorophenyl)furan |
| SMILES | Fc1ccc(-c2coc(-c3ccc(F)cc3)c2F)cc1 |
| InChI | InChI=1S/C16H9F3O/c17-12-5-1-10(2-6-12)14-9-20-16(15(14)19)11-3-7-13(18)8-4-11/h1-9H |
| InChIKey | VRHAVHFQFYDSQA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |