C21H46OSiSn — CID 135027369
trimethyl-[(1S,3R)-3-(tributylstannylmethyl)cyclopentyl]oxysilane (PubChem CID 135027369) has the molecular formula C21H46OSiSn and a molecular weight of 461.40 g/mol. Its IUPAC name is trimethyl-[(1S,3R)-3-(tributylstannylmethyl)cyclopentyl]oxysilane.
| Compound Name | trimethyl-[(1S,3R)-3-(tributylstannylmethyl)cyclopentyl]oxysilane |
|---|---|
| PubChem CID | 135027369 |
| Molecular Formula | C21H46OSiSn |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | trimethyl-[(1S,3R)-3-(tributylstannylmethyl)cyclopentyl]oxysilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C[C@@H]1CC[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C9H19OSi.3C4H9.Sn/c1-8-5-6-9(7-8)10-11(2,3)4;3*1-3-4-2;/h8-9H,1,5-7H2,2-4H3;3*1,3-4H2,2H3;/t8-,9+;;;;/m1..../s1 |
| InChIKey | BGMCHQSUFFFXPP-UKTYMXBTSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|