C9H20OSi — CID 11365831
trimethyl-[(1R,2S)-2-methylcyclopentyl]oxysilane (PubChem CID 11365831) has the molecular formula C9H20OSi and a molecular weight of 172.34 g/mol. Its IUPAC name is trimethyl-[(1R,2S)-2-methylcyclopentyl]oxysilane.
| Compound Name | trimethyl-[(1R,2S)-2-methylcyclopentyl]oxysilane |
|---|---|
| PubChem CID | 11365831 |
| Molecular Formula | C9H20OSi |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | trimethyl-[(1R,2S)-2-methylcyclopentyl]oxysilane |
| SMILES | C[C@H]1CCC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C9H20OSi/c1-8-6-5-7-9(8)10-11(2,3)4/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | PASJUDIXFAWCSJ-DTWKUNHWSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|