C12H25LiOSi — CID 134895891
lithium tert-butyl-[(1S,2R)-2-methanidylcyclopentyl]oxy-dimethylsilane (PubChem CID 134895891) has the molecular formula C12H25LiOSi and a molecular weight of 220.36 g/mol. Its IUPAC name is lithium tert-butyl-[(1S,2R)-2-methanidylcyclopentyl]oxy-dimethylsilane.
| Compound Name | lithium tert-butyl-[(1S,2R)-2-methanidylcyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134895891 |
| Molecular Formula | C12H25LiOSi |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | lithium tert-butyl-[(1S,2R)-2-methanidylcyclopentyl]oxy-dimethylsilane |
| SMILES | [CH2-][C@@H]1CCC[C@@H]1O[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C12H25OSi.Li/c1-10-8-7-9-11(10)13-14(5,6)12(2,3)4;/h10-11H,1,7-9H2,2-6H3;/q-1;+1/t10-,11+;/m1./s1 |
| InChIKey | XNHKOBLZNQIQSE-DHXVBOOMSA-N |
| XLogP | 1.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|