C12H24OSi — CID 135060358
[(1R,2R,5S)-2-bicyclo[3.1.0]hexanyl]oxy-tert-butyl-dimethylsilane (PubChem CID 135060358) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is [(1R,2R,5S)-2-bicyclo[3.1.0]hexanyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,5S)-2-bicyclo[3.1.0]hexanyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135060358 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | [(1R,2R,5S)-2-bicyclo[3.1.0]hexanyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H]2C[C@H]21 |
| InChI | InChI=1S/C12H24OSi/c1-12(2,3)14(4,5)13-11-7-6-9-8-10(9)11/h9-11H,6-8H2,1-5H3/t9-,10+,11+/m0/s1 |
| InChIKey | BIEFIBVIBKDCSE-HBNTYKKESA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|