C23H21NO2 — CID 135027685
ethyl 3,3-diphenyl-2H-indolizine-1-carboxylate (PubChem CID 135027685) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 3,3-diphenyl-2H-indolizine-1-carboxylate.
| Compound Name | ethyl 3,3-diphenyl-2H-indolizine-1-carboxylate |
|---|---|
| PubChem CID | 135027685 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | ethyl 3,3-diphenyl-2H-indolizine-1-carboxylate |
| SMILES | CCOC(=O)C1=C2C=CC=CN2C(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H21NO2/c1-2-26-22(25)20-17-23(18-11-5-3-6-12-18,19-13-7-4-8-14-19)24-16-10-9-15-21(20)24/h3-16H,2,17H2,1H3 |
| InChIKey | ZHBPQCSHVYPPGD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |