C7H13IO2 — CID 135027786
(E,3S,4R)-1-iodo-3-methylhex-1-ene-3,4-diol (PubChem CID 135027786) has the molecular formula C7H13IO2 and a molecular weight of 256.08 g/mol. Its IUPAC name is (E,3S,4R)-1-iodo-3-methylhex-1-ene-3,4-diol.
| Compound Name | (E,3S,4R)-1-iodo-3-methylhex-1-ene-3,4-diol |
|---|---|
| PubChem CID | 135027786 |
| Molecular Formula | C7H13IO2 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | (E,3S,4R)-1-iodo-3-methylhex-1-ene-3,4-diol |
| SMILES | CC[C@@H](O)[C@@](C)(O)/C=C/I |
| InChI | InChI=1S/C7H13IO2/c1-3-6(9)7(2,10)4-5-8/h4-6,9-10H,3H2,1-2H3/b5-4+/t6-,7+/m1/s1 |
| InChIKey | XGLMKVTZZKJVRI-ZVCMNORXSA-N |
| XLogP | 1.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|