C29H39NO7Si — CID 135028277
2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,2R,6S,7S,10S)-7-[(1S)-1,2-dihydroxyethyl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethanone (PubChem CID 135028277) has the molecular formula C29H39NO7Si and a molecular weight of 541.72 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,2R,6S,7S,10S)-7-[(1S)-1,2-dihydroxyethyl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethanone.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,2R,6S,7S,10S)-7-[(1S)-1,2-dihydroxyethyl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethanone |
|---|---|
| PubChem CID | 135028277 |
| Molecular Formula | C29H39NO7Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,2R,6S,7S,10S)-7-[(1S)-1,2-dihydroxyethyl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethanone |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H]1C[C@@H](C(=O)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)ON1[C@H]2[C@H](O)CO |
| InChI | InChI=1S/C29H39NO7Si/c1-28(2,3)38(19-12-8-6-9-13-19,20-14-10-7-11-15-20)34-18-23(33)24-16-21-26-27(36-29(4,5)35-26)25(22(32)17-31)30(21)37-24/h6-15,21-22,24-27,31-32H,16-18H2,1-5H3/t21-,22+,24-,25-,26+,27-/m0/s1 |
| InChIKey | RKASZXXXDBASHP-PJUCLVMXSA-N |
| XLogP | 1.76 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|