C27H37NO4Si — CID 11081133
tert-butyl-[2-[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethoxy]-diphenylsilane (PubChem CID 11081133) has the molecular formula C27H37NO4Si and a molecular weight of 467.68 g/mol. Its IUPAC name is tert-butyl-[2-[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11081133 |
| Molecular Formula | C27H37NO4Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl-[2-[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN3O[C@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C[C@@H]23)O1 |
| InChI | InChI=1S/C27H37NO4Si/c1-26(2,3)33(21-12-8-6-9-13-21,22-14-10-7-11-15-22)29-17-16-20-18-23-25-24(19-28(23)32-20)30-27(4,5)31-25/h6-15,20,23-25H,16-19H2,1-5H3/t20-,23+,24-,25+/m1/s1 |
| InChIKey | NBSQCSITVNOPPJ-YFJHUXEUSA-N |
| XLogP | 3.86 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|