C22H35NO5Si — CID 72736500
[(3aS,4S,6R,6aR)-6-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]oxy-trimethylsilane (PubChem CID 72736500) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-6-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]oxy-trimethylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-6-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 72736500 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | [(3aS,4S,6R,6aR)-6-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]oxy-trimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Cc1ccccc1)N(O[Si](C)(C)C)[C@H]2[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H35NO5Si/c1-21(2)24-14-17(25-21)18-20-19(26-22(3,4)27-20)16(23(18)28-29(5,6)7)13-15-11-9-8-10-12-15/h8-12,16-20H,13-14H2,1-7H3/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | KHJVQFRRCZQLMM-CXQPBAHBSA-N |
| XLogP | 3.72 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|