C24H40NO3Si+ — CID 53494613
[(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 53494613) has the molecular formula C24H40NO3Si+ and a molecular weight of 418.67 g/mol. Its IUPAC name is [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53494613 |
| Molecular Formula | C24H40NO3Si+ |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](CO[Si](C)(C)C(C)(C)C)[N+]1(Cc3ccccc3)CCC[C@@H]21 |
| InChI | InChI=1S/C24H40NO3Si/c1-23(2,3)29(6,7)26-17-20-22-21(27-24(4,5)28-22)19-14-11-15-25(19,20)16-18-12-9-8-10-13-18/h8-10,12-13,19-22H,11,14-17H2,1-7H3/q+1/t19-,20-,21-,22+,25?/m0/s1 |
| InChIKey | KZDJIVSISSWQJC-LBNYSLGASA-N |
| XLogP | 5.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|