C34H49NO8Si — CID 135028276
tert-butyl-[2-[(1S,2R,6S,7S,10S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]-2,2-dimethoxyethoxy]-diphenylsilane (PubChem CID 135028276) has the molecular formula C34H49NO8Si and a molecular weight of 627.85 g/mol. Its IUPAC name is tert-butyl-[2-[(1S,2R,6S,7S,10S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]-2,2-dimethoxyethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(1S,2R,6S,7S,10S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]-2,2-dimethoxyethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135028276 |
| Molecular Formula | C34H49NO8Si |
| Molecular Weight | 627.85 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | tert-butyl-[2-[(1S,2R,6S,7S,10S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]-2,2-dimethoxyethoxy]-diphenylsilane |
| SMILES | COC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(OC)[C@@H]1C[C@H]2[C@H]3OC(C)(C)O[C@H]3[C@H]([C@H]3COC(C)(C)O3)N2O1 |
| InChI | InChI=1S/C34H49NO8Si/c1-31(2,3)44(23-16-12-10-13-17-23,24-18-14-11-15-19-24)39-22-34(36-8,37-9)27-20-25-29-30(42-33(6,7)41-29)28(35(25)43-27)26-21-38-32(4,5)40-26/h10-19,25-30H,20-22H2,1-9H3/t25-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | AMKDGKCPWPYPBG-GDHIHDRFSA-N |
| XLogP | 3.98 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|