C26H35NO4Si — CID 11812463
tert-butyl-[[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]methoxy]-diphenylsilane (PubChem CID 11812463) has the molecular formula C26H35NO4Si and a molecular weight of 453.66 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11812463 |
| Molecular Formula | C26H35NO4Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl-[[(1S,2S,6R,10S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl]methoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN3O[C@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C[C@@H]23)O1 |
| InChI | InChI=1S/C26H35NO4Si/c1-25(2,3)32(20-12-8-6-9-13-20,21-14-10-7-11-15-21)28-18-19-16-22-24-23(17-27(22)31-19)29-26(4,5)30-24/h6-15,19,22-24H,16-18H2,1-5H3/t19-,22-,23+,24-/m0/s1 |
| InChIKey | SZRZXPBJDSWDFP-LSUHJGNXSA-N |
| XLogP | 3.47 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|