C27H39NO6Si — CID 10994721
[(2S,3aS,4S,5S)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10994721) has the molecular formula C27H39NO6Si and a molecular weight of 501.70 g/mol. Its IUPAC name is [(2S,3aS,4S,5S)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3aS,4S,5S)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10994721 |
| Molecular Formula | C27H39NO6Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(2S,3aS,4S,5S)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | COCO[C@@H]1[C@@H](OCOC)CN2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C27H39NO6Si/c1-27(2,3)35(22-12-8-6-9-13-22,23-14-10-7-11-15-23)33-18-21-16-24-26(32-20-30-5)25(31-19-29-4)17-28(24)34-21/h6-15,21,24-26H,16-20H2,1-5H3/t21-,24-,25-,26-/m0/s1 |
| InChIKey | VIOWFXVLJWQOMP-PZYJALBSSA-N |
| XLogP | 2.93 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|